C21H28N2O4 — CID 25489004
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]urea (PubChem CID 25489004) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]urea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 25489004 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]urea |
| SMILES | COc1ccc(CCNC(=O)N[C@H](C)CCc2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C21H28N2O4/c1-15(4-5-16-6-9-18(24)10-7-16)23-21(25)22-13-12-17-8-11-19(26-2)20(14-17)27-3/h6-11,14-15,24H,4-5,12-13H2,1-3H3,(H2,22,23,25)/t15-/m1/s1 |
| InChIKey | BFKRMUKWDLJFLW-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |