C19H23BrN2O3 — CID 108891454
1-[2-(4-bromophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 108891454) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108891454 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NCCc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C19H23BrN2O3/c1-24-17-8-5-15(13-18(17)25-2)10-12-22-19(23)21-11-9-14-3-6-16(20)7-4-14/h3-8,13H,9-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | RMMNXTAMWZLPIP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |