C19H23BrN2O3 — CID 108902279
1-[2-(4-bromophenyl)ethyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 108902279) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108902279 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCCc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C19H23BrN2O3/c1-13(15-6-9-17(24-2)18(12-15)25-3)22-19(23)21-11-10-14-4-7-16(20)8-5-14/h4-9,12-13H,10-11H2,1-3H3,(H2,21,22,23) |
| InChIKey | DLPBCOOEVLUBSR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |