C17H26ClN3O4 — CID 124885683
(2R)-2-chloro-N-[2-[[(1S)-1-(4-ethoxy-3-methoxyphenyl)ethyl]carbamoylamino]ethyl]propanamide (PubChem CID 124885683) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-[[(1S)-1-(4-ethoxy-3-methoxyphenyl)ethyl]carbamoylamino]ethyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[2-[[(1S)-1-(4-ethoxy-3-methoxyphenyl)ethyl]carbamoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 124885683 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2R)-2-chloro-N-[2-[[(1S)-1-(4-ethoxy-3-methoxyphenyl)ethyl]carbamoylamino]ethyl]propanamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)NCCNC(=O)[C@@H](C)Cl)cc1OC |
| InChI | InChI=1S/C17H26ClN3O4/c1-5-25-14-7-6-13(10-15(14)24-4)12(3)21-17(23)20-9-8-19-16(22)11(2)18/h6-7,10-12H,5,8-9H2,1-4H3,(H,19,22)(H2,20,21,23)/t11-,12+/m1/s1 |
| InChIKey | KUIZYNNGEPGMFO-NEPJUHHUSA-N |
| XLogP | 2.20 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|