C14H20ClNO3 — CID 3554699
2-chloro-N-[1-(3,4-diethoxyphenyl)ethyl]acetamide (PubChem CID 3554699) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-chloro-N-[1-(3,4-diethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[1-(3,4-diethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 3554699 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-chloro-N-[1-(3,4-diethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(C(C)NC(=O)CCl)cc1OCC |
| InChI | InChI=1S/C14H20ClNO3/c1-4-18-12-7-6-11(8-13(12)19-5-2)10(3)16-14(17)9-15/h6-8,10H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | VIIOLUSYMWLHOV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|