C19H26N4O3 — CID 55787245
N-[1-(3,4-diethoxyphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide (PubChem CID 55787245) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide |
|---|---|
| PubChem CID | 55787245 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide |
| SMILES | CCOc1ccc(C(C)NC(=O)CCNc2ncccn2)cc1OCC |
| InChI | InChI=1S/C19H26N4O3/c1-4-25-16-8-7-15(13-17(16)26-5-2)14(3)23-18(24)9-12-22-19-20-10-6-11-21-19/h6-8,10-11,13-14H,4-5,9,12H2,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | HTZGBGAUEBTKBR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |