C16H20N4OS — CID 94448615
N-[(1S)-1-(4-methylsulfanylphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide (PubChem CID 94448615) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[(1S)-1-(4-methylsulfanylphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide.
| Compound Name | N-[(1S)-1-(4-methylsulfanylphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide |
|---|---|
| PubChem CID | 94448615 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[(1S)-1-(4-methylsulfanylphenyl)ethyl]-3-(pyrimidin-2-ylamino)propanamide |
| SMILES | CSc1ccc([C@H](C)NC(=O)CCNc2ncccn2)cc1 |
| InChI | InChI=1S/C16H20N4OS/c1-12(13-4-6-14(22-2)7-5-13)20-15(21)8-11-19-16-17-9-3-10-18-16/h3-7,9-10,12H,8,11H2,1-2H3,(H,20,21)(H,17,18,19)/t12-/m0/s1 |
| InChIKey | FQCPNRFPDWIPDG-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |