C21H27NO3S — CID 9437337
N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3-phenylsulfanylpropanamide (PubChem CID 9437337) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3-phenylsulfanylpropanamide.
| Compound Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 9437337 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3-phenylsulfanylpropanamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)CCSc2ccccc2)cc1OCC |
| InChI | InChI=1S/C21H27NO3S/c1-4-24-19-12-11-17(15-20(19)25-5-2)16(3)22-21(23)13-14-26-18-9-7-6-8-10-18/h6-12,15-16H,4-5,13-14H2,1-3H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | NEELLKINBUAXCL-INIZCTEOSA-N |
| XLogP | 4.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |