C26H29NO4 — CID 9092058
N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-4-naphthalen-2-yl-4-oxobutanamide (PubChem CID 9092058) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-4-naphthalen-2-yl-4-oxobutanamide.
| Compound Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-4-naphthalen-2-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 9092058 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-4-naphthalen-2-yl-4-oxobutanamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)CCC(=O)c2ccc3ccccc3c2)cc1OCC |
| InChI | InChI=1S/C26H29NO4/c1-4-30-24-14-12-20(17-25(24)31-5-2)18(3)27-26(29)15-13-23(28)22-11-10-19-8-6-7-9-21(19)16-22/h6-12,14,16-18H,4-5,13,15H2,1-3H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | DQBMXDDXELOREV-SFHVURJKSA-N |
| XLogP | 5.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |