C18H30N2O4 — CID 138015146
N-[1-(3,4-diethoxyphenyl)ethyl]-4-(dimethylamino)-3-hydroxybutanamide (PubChem CID 138015146) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-4-(dimethylamino)-3-hydroxybutanamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-4-(dimethylamino)-3-hydroxybutanamide |
|---|---|
| PubChem CID | 138015146 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-4-(dimethylamino)-3-hydroxybutanamide |
| SMILES | CCOc1ccc(C(C)NC(=O)CC(O)CN(C)C)cc1OCC |
| InChI | InChI=1S/C18H30N2O4/c1-6-23-16-9-8-14(10-17(16)24-7-2)13(3)19-18(22)11-15(21)12-20(4)5/h8-10,13,15,21H,6-7,11-12H2,1-5H3,(H,19,22) |
| InChIKey | DQOZSYFKMKBQKA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |