C18H20F2N2O3 — CID 51274117
1-[1-(3,4-difluorophenyl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 51274117) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 51274117 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NC(C)c2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C18H20F2N2O3/c1-11(13-5-6-14(19)15(20)9-13)22-18(23)21-10-12-4-7-16(24-2)17(8-12)25-3/h4-9,11H,10H2,1-3H3,(H2,21,22,23) |
| InChIKey | SUTXTRHLGSQFBK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |