C13H17F2N3O2 — CID 119059639
(2S)-2-[(3,4-difluorophenyl)methylcarbamoylamino]-3-methylbutanamide (PubChem CID 119059639) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is (2S)-2-[(3,4-difluorophenyl)methylcarbamoylamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[(3,4-difluorophenyl)methylcarbamoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 119059639 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2S)-2-[(3,4-difluorophenyl)methylcarbamoylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)NCc1ccc(F)c(F)c1)C(N)=O |
| InChI | InChI=1S/C13H17F2N3O2/c1-7(2)11(12(16)19)18-13(20)17-6-8-3-4-9(14)10(15)5-8/h3-5,7,11H,6H2,1-2H3,(H2,16,19)(H2,17,18,20)/t11-/m0/s1 |
| InChIKey | ATJCJZGCYSNEFK-NSHDSACASA-N |
| XLogP | 1.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |