C17H27N3O4 — CID 47075828
N-tert-butyl-2-[(3,4-dimethoxyphenyl)methylcarbamoylamino]propanamide (PubChem CID 47075828) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-tert-butyl-2-[(3,4-dimethoxyphenyl)methylcarbamoylamino]propanamide.
| Compound Name | N-tert-butyl-2-[(3,4-dimethoxyphenyl)methylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 47075828 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-tert-butyl-2-[(3,4-dimethoxyphenyl)methylcarbamoylamino]propanamide |
| SMILES | COc1ccc(CNC(=O)NC(C)C(=O)NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H27N3O4/c1-11(15(21)20-17(2,3)4)19-16(22)18-10-12-7-8-13(23-5)14(9-12)24-6/h7-9,11H,10H2,1-6H3,(H,20,21)(H2,18,19,22) |
| InChIKey | QMAUVFKNTCRQEM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |