C18H28N2O4 — CID 108965097
N-tert-butyl-N'-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethylpropanediamide (PubChem CID 108965097) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-tert-butyl-N'-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethylpropanediamide.
| Compound Name | N-tert-butyl-N'-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965097 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-tert-butyl-N'-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(CNC(=O)C(C)(C)C(=O)NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C18H28N2O4/c1-17(2,3)20-16(22)18(4,5)15(21)19-11-12-8-9-13(23-6)14(10-12)24-7/h8-10H,11H2,1-7H3,(H,19,21)(H,20,22) |
| InChIKey | IIRYRRJZXXDALZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|