C21H27N3O4 — CID 108963657
N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide (PubChem CID 108963657) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963657 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide |
| SMILES | COc1ccc(CCNC(=O)C(C)(C)C(=O)NCc2ccncc2)cc1OC |
| InChI | InChI=1S/C21H27N3O4/c1-21(2,20(26)24-14-16-7-10-22-11-8-16)19(25)23-12-9-15-5-6-17(27-3)18(13-15)28-4/h5-8,10-11,13H,9,12,14H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | MXQRBKORFXHUMX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|