C21H32N2O4 — CID 108958959
N-cyclohexyl-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108958959) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-cyclohexyl-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-cyclohexyl-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108958959 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N-cyclohexyl-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(CCNC(=O)C(C)(C)C(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C21H32N2O4/c1-21(2,20(25)23-16-8-6-5-7-9-16)19(24)22-13-12-15-10-11-17(26-3)18(14-15)27-4/h10-11,14,16H,5-9,12-13H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | AMLWENJURWBFQP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|