C20H32N4O3 — CID 111075449
3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N-cyclohexylpropanamide (PubChem CID 111075449) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 111075449 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N-cyclohexylpropanamide |
| SMILES | COc1ccc(CCN/C(N)=N/CCC(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C20H32N4O3/c1-26-17-9-8-15(14-18(17)27-2)10-12-22-20(21)23-13-11-19(25)24-16-6-4-3-5-7-16/h8-9,14,16H,3-7,10-13H2,1-2H3,(H,24,25)(H3,21,22,23) |
| InChIKey | BVKSALGTJQZGGW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|