C18H28N4O3 — CID 111075467
3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-N-cyclohexylpropanamide (PubChem CID 111075467) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 111075467 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-N-cyclohexylpropanamide |
| SMILES | COc1ccc(N/C(N)=N/CCC(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C18H28N4O3/c1-24-15-9-8-14(12-16(15)25-2)22-18(19)20-11-10-17(23)21-13-6-4-3-5-7-13/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,21,23)(H3,19,20,22) |
| InChIKey | NNFUTYIBNMOHNY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|