C19H28N4O3 — CID 111075501
3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-N-cyclohexylpropanamide (PubChem CID 111075501) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 111075501 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-N-cyclohexylpropanamide |
| SMILES | N/C(=N\CCC(=O)NC1CCCCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H28N4O3/c20-19(21-10-9-18(24)22-14-5-2-1-3-6-14)23-15-7-8-16-17(13-15)26-12-4-11-25-16/h7-8,13-14H,1-6,9-12H2,(H,22,24)(H3,20,21,23) |
| InChIKey | CBICMIAWQLJXND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|