C19H29IN4O3 — CID 111094927
N-[2-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]ethyl]-2-cyclopentylacetamide;hydroiodide (PubChem CID 111094927) has the molecular formula C19H29IN4O3 and a molecular weight of 488.37 g/mol. Its IUPAC name is N-[2-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]ethyl]-2-cyclopentylacetamide;hydroiodide.
| Compound Name | N-[2-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]ethyl]-2-cyclopentylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111094927 |
| Molecular Formula | C19H29IN4O3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N-[2-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]ethyl]-2-cyclopentylacetamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)CC1CCCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H28N4O3.HI/c20-19(22-9-8-21-18(24)12-14-4-1-2-5-14)23-15-6-7-16-17(13-15)26-11-3-10-25-16;/h6-7,13-14H,1-5,8-12H2,(H,21,24)(H3,20,22,23);1H |
| InChIKey | WHKSHSTWGKGXIP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|