C14H23IN4O4S — CID 119118816
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide (PubChem CID 119118816) has the molecular formula C14H23IN4O4S and a molecular weight of 470.33 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119118816 |
| Molecular Formula | C14H23IN4O4S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(ethylsulfonylamino)ethyl]guanidine;hydroiodide |
| SMILES | CCS(=O)(=O)NCC/N=C(\N)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C14H22N4O4S.HI/c1-2-23(19,20)17-7-6-16-14(15)18-11-4-5-12-13(10-11)22-9-3-8-21-12;/h4-5,10,17H,2-3,6-9H2,1H3,(H3,15,16,18);1H |
| InChIKey | PPNWCLAZBOSKFC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|