C15H25IN4O4S — CID 119120952
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine;hydroiodide (PubChem CID 119120952) has the molecular formula C15H25IN4O4S and a molecular weight of 484.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119120952 |
| Molecular Formula | C15H25IN4O4S |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine;hydroiodide |
| SMILES | CC(C)NS(=O)(=O)CC/N=C(\N)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C15H24N4O4S.HI/c1-11(2)19-24(20,21)9-6-17-15(16)18-12-4-5-13-14(10-12)23-8-3-7-22-13;/h4-5,10-11,19H,3,6-9H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | XRPSGWRYGPYSKN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|