C19H23IN4O3 — CID 119118040
N-[4-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 119118040) has the molecular formula C19H23IN4O3 and a molecular weight of 482.32 g/mol. Its IUPAC name is N-[4-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[4-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 119118040 |
| Molecular Formula | C19H23IN4O3 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[4-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CC(=O)Nc1ccc(C/N=C(\N)Nc2ccc3c(c2)OCCCO3)cc1.I |
| InChI | InChI=1S/C19H22N4O3.HI/c1-13(24)22-15-5-3-14(4-6-15)12-21-19(20)23-16-7-8-17-18(11-16)26-10-2-9-25-17;/h3-8,11H,2,9-10,12H2,1H3,(H,22,24)(H3,20,21,23);1H |
| InChIKey | QKTOSXXRVCEUSZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|