C24H31IN4O3 — CID 111074088
N-[3-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide (PubChem CID 111074088) has the molecular formula C24H31IN4O3 and a molecular weight of 550.44 g/mol. Its IUPAC name is N-[3-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111074088 |
| Molecular Formula | C24H31IN4O3 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | N-[3-[[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)C2CCCCC2)c1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H30N4O3.HI/c25-24(28-20-10-11-21-22(15-20)31-13-5-12-30-21)26-16-17-6-4-9-19(14-17)27-23(29)18-7-2-1-3-8-18;/h4,6,9-11,14-15,18H,1-3,5,7-8,12-13,16H2,(H,27,29)(H3,25,26,28);1H |
| InChIKey | UBEASBUXPZLMHF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|