C21H27IN4O — CID 110926046
N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide (PubChem CID 110926046) has the molecular formula C21H27IN4O and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 110926046 |
| Molecular Formula | C21H27IN4O |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)C2CCCCC2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C21H26N4O.HI/c22-21(25-18-11-5-2-6-12-18)23-15-16-8-7-13-19(14-16)24-20(26)17-9-3-1-4-10-17;/h2,5-8,11-14,17H,1,3-4,9-10,15H2,(H,24,26)(H3,22,23,25);1H |
| InChIKey | OPMBTXDYMOFATQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|