C16H24N4O — CID 111046823
N-[3-[[[amino(propylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111046823) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is N-[3-[[[amino(propylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[amino(propylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111046823 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[3-[[[amino(propylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CCCN/C(N)=N/Cc1cccc(NC(=O)C2CCC2)c1 |
| InChI | InChI=1S/C16H24N4O/c1-2-9-18-16(17)19-11-12-5-3-8-14(10-12)20-15(21)13-6-4-7-13/h3,5,8,10,13H,2,4,6-7,9,11H2,1H3,(H,20,21)(H3,17,18,19) |
| InChIKey | XZFASXSHVSACIC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|