C23H30N4O — CID 111901141
N-[3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111901141) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111901141 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-[3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NCc1cccc(NC(=O)C2CCC2)c1 |
| InChI | InChI=1S/C23H30N4O/c1-3-24-23(25-15-18-8-4-7-17(2)13-18)26-16-19-9-5-12-21(14-19)27-22(28)20-10-6-11-20/h4-5,7-9,12-14,20H,3,6,10-11,15-16H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | RKNGLWCRYICTQZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|