C22H36IN5O3 — CID 111885344
tert-butyl N-[2-[[N'-[[3-(cyclobutanecarbonylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111885344) has the molecular formula C22H36IN5O3 and a molecular weight of 545.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[[3-(cyclobutanecarbonylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-[[3-(cyclobutanecarbonylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885344 |
| Molecular Formula | C22H36IN5O3 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | tert-butyl N-[2-[[N'-[[3-(cyclobutanecarbonylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C22H35N5O3.HI/c1-5-23-20(24-12-13-25-21(29)30-22(2,3)4)26-15-16-8-6-11-18(14-16)27-19(28)17-9-7-10-17;/h6,8,11,14,17H,5,7,9-10,12-13,15H2,1-4H3,(H,25,29)(H,27,28)(H2,23,24,26);1H |
| InChIKey | RMJPVBMVKLXQDG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|