C25H34N4O3 — CID 111213695
N-[3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111213695) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111213695 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H34N4O3/c1-4-26-25(27-14-13-18-11-12-22(31-2)23(16-18)32-3)28-17-19-7-5-10-21(15-19)29-24(30)20-8-6-9-20/h5,7,10-12,15-16,20H,4,6,8-9,13-14,17H2,1-3H3,(H,29,30)(H2,26,27,28) |
| InChIKey | SRNWVQXJABFCOO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|