C21H36IN5O3 — CID 111885142
tert-butyl N-[2-[[N'-[[3-(butanoylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111885142) has the molecular formula C21H36IN5O3 and a molecular weight of 533.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[[3-(butanoylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-[[3-(butanoylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885142 |
| Molecular Formula | C21H36IN5O3 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | tert-butyl N-[2-[[N'-[[3-(butanoylamino)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\NCC)NCCNC(=O)OC(C)(C)C)c1.I |
| InChI | InChI=1S/C21H35N5O3.HI/c1-6-9-18(27)26-17-11-8-10-16(14-17)15-25-19(22-7-2)23-12-13-24-20(28)29-21(3,4)5;/h8,10-11,14H,6-7,9,12-13,15H2,1-5H3,(H,24,28)(H,26,27)(H2,22,23,25);1H |
| InChIKey | RPYJMUHGAYYOEW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|