C22H39IN4O2 — CID 111716439
N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111716439) has the molecular formula C22H39IN4O2 and a molecular weight of 518.48 g/mol. Its IUPAC name is N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111716439 |
| Molecular Formula | C22H39IN4O2 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\NCC)NCC(CC)(CC)CCO)c1.I |
| InChI | InChI=1S/C22H38N4O2.HI/c1-5-10-20(28)26-19-12-9-11-18(15-19)16-24-21(23-8-4)25-17-22(6-2,7-3)13-14-27;/h9,11-12,15,27H,5-8,10,13-14,16-17H2,1-4H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | HLJSFWHJXKFJQW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|