C23H35IN4O3 — CID 111716017
N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111716017) has the molecular formula C23H35IN4O3 and a molecular weight of 542.46 g/mol. Its IUPAC name is N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111716017 |
| Molecular Formula | C23H35IN4O3 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | N-[3-[[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCC(CC)(CC)CCO.I |
| InChI | InChI=1S/C23H34N4O3.HI/c1-4-23(5-2,12-13-28)17-26-22(24-6-3)25-16-18-9-7-10-19(15-18)27-21(29)20-11-8-14-30-20;/h7-11,14-15,28H,4-6,12-13,16-17H2,1-3H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | CUPOIOYEQAZOLS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|