C24H29IN4O3 — CID 109416851
N-[3-[[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 109416851) has the molecular formula C24H29IN4O3 and a molecular weight of 548.43 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109416851 |
| Molecular Formula | C24H29IN4O3 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | N-[3-[[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCC(C)(O)c1ccccc1.I |
| InChI | InChI=1S/C24H28N4O3.HI/c1-3-25-23(27-17-24(2,30)19-10-5-4-6-11-19)26-16-18-9-7-12-20(15-18)28-22(29)21-13-8-14-31-21;/h4-15,30H,3,16-17H2,1-2H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | AWEMFZWVGOZHCE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|