C20H23IN4O3 — CID 110938639
N-[3-[[[ethylamino-(furan-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 110938639) has the molecular formula C20H23IN4O3 and a molecular weight of 494.33 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(furan-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-(furan-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110938639 |
| Molecular Formula | C20H23IN4O3 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[3-[[[ethylamino-(furan-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCc1ccco1.I |
| InChI | InChI=1S/C20H22N4O3.HI/c1-2-21-20(23-14-17-8-4-10-26-17)22-13-15-6-3-7-16(12-15)24-19(25)18-9-5-11-27-18;/h3-12H,2,13-14H2,1H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | XADAYCMZLJCXSP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|