C21H24IN5O2 — CID 110970616
N-[3-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 110970616) has the molecular formula C21H24IN5O2 and a molecular weight of 505.36 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110970616 |
| Molecular Formula | C21H24IN5O2 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-[3-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCc1ccccn1.I |
| InChI | InChI=1S/C21H23N5O2.HI/c1-2-22-21(25-15-18-8-3-4-11-23-18)24-14-16-7-5-9-17(13-16)26-20(27)19-10-6-12-28-19;/h3-13H,2,14-15H2,1H3,(H,26,27)(H2,22,24,25);1H |
| InChIKey | MKNDUYUUPIXSLC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|