C18H15N3O3 — CID 17297031
N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 17297031) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17297031 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C18H15N3O3/c22-17(20-12-15-6-1-2-9-19-15)13-5-3-7-14(11-13)21-18(23)16-8-4-10-24-16/h1-11H,12H2,(H,20,22)(H,21,23) |
| InChIKey | ROBQMGXWPPFWHY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |