C22H16BrN3O3 — CID 55782670
7-bromo-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 55782670) has the molecular formula C22H16BrN3O3 and a molecular weight of 450.29 g/mol. Its IUPAC name is 7-bromo-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55782670 |
| Molecular Formula | C22H16BrN3O3 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 7-bromo-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(NC(=O)c2cc3cccc(Br)c3o2)c1 |
| InChI | InChI=1S/C22H16BrN3O3/c23-18-9-4-5-14-12-19(29-20(14)18)22(28)26-16-8-3-6-15(11-16)21(27)25-13-17-7-1-2-10-24-17/h1-12H,13H2,(H,25,27)(H,26,28) |
| InChIKey | HTDDXDFCQHMOAS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |