C27H20FN3O3 — CID 60555105
2-(4-fluorobenzoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 60555105) has the molecular formula C27H20FN3O3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-(4-fluorobenzoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-(4-fluorobenzoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 60555105 |
| Molecular Formula | C27H20FN3O3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-(4-fluorobenzoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(NC(=O)c2ccccc2C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H20FN3O3/c28-20-13-11-18(12-14-20)25(32)23-9-1-2-10-24(23)27(34)31-21-8-5-6-19(16-21)26(33)30-17-22-7-3-4-15-29-22/h1-16H,17H2,(H,30,33)(H,31,34) |
| InChIKey | BNAOTRMCNRYHDV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |