C26H22N4O2 — CID 60554928
2-cyclopropyl-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]quinoline-4-carboxamide (PubChem CID 60554928) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-cyclopropyl-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 60554928 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-cyclopropyl-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(NC(=O)c2cc(C3CC3)nc3ccccc23)c1 |
| InChI | InChI=1S/C26H22N4O2/c31-25(28-16-20-7-3-4-13-27-20)18-6-5-8-19(14-18)29-26(32)22-15-24(17-11-12-17)30-23-10-2-1-9-21(22)23/h1-10,13-15,17H,11-12,16H2,(H,28,31)(H,29,32) |
| InChIKey | UPALIEZDILRYNR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |