C20H15ClFN3O2 — CID 55783783
2-chloro-4-fluoro-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 55783783) has the molecular formula C20H15ClFN3O2 and a molecular weight of 383.81 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55783783 |
| Molecular Formula | C20H15ClFN3O2 |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-chloro-4-fluoro-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(NC(=O)c2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C20H15ClFN3O2/c21-18-11-14(22)7-8-17(18)20(27)25-15-6-3-4-13(10-15)19(26)24-12-16-5-1-2-9-23-16/h1-11H,12H2,(H,24,26)(H,25,27) |
| InChIKey | WWSACYJJLPKOGT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |