C22H17Cl2N3O2 — CID 98827364
3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]amino]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 98827364) has the molecular formula C22H17Cl2N3O2 and a molecular weight of 426.30 g/mol. Its IUPAC name is 3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]amino]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]amino]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 98827364 |
| Molecular Formula | C22H17Cl2N3O2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]amino]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1Cl)Nc1cccc(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C22H17Cl2N3O2/c23-17-8-9-20(24)15(12-17)7-10-21(28)27-18-6-3-4-16(13-18)22(29)26-14-19-5-1-2-11-25-19/h1-13H,14H2,(H,26,29)(H,27,28)/b10-7+ |
| InChIKey | PZFQAOQJMNKSDR-JXMROGBWSA-N |
| XLogP | 4.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|