C16H10Cl2N4OS — CID 55810478
(E)-3-(2,5-dichlorophenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 55810478) has the molecular formula C16H10Cl2N4OS and a molecular weight of 377.26 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55810478 |
| Molecular Formula | C16H10Cl2N4OS |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1Cl)Nc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C16H10Cl2N4OS/c17-11-5-6-12(18)10(9-11)4-7-14(23)20-16-22-21-15(24-16)13-3-1-2-8-19-13/h1-9H,(H,20,22,23)/b7-4+ |
| InChIKey | QWFAVEFQDDXQBG-QPJJXVBHSA-N |
| XLogP | 4.56 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|