C14H8ClIN4OS — CID 55810604
4-chloro-2-iodo-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 55810604) has the molecular formula C14H8ClIN4OS and a molecular weight of 442.67 g/mol. Its IUPAC name is 4-chloro-2-iodo-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-chloro-2-iodo-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55810604 |
| Molecular Formula | C14H8ClIN4OS |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 441.92 |
| IUPAC Name | 4-chloro-2-iodo-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccn2)s1)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C14H8ClIN4OS/c15-8-4-5-9(10(16)7-8)12(21)18-14-20-19-13(22-14)11-3-1-2-6-17-11/h1-7H,(H,18,20,21) |
| InChIKey | BICGUNZQJQGVTN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|