C13H16N4OS — CID 47251913
4-methyl-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 47251913) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-methyl-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | 4-methyl-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 47251913 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-methyl-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | CC(C)CCC(=O)Nc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C13H16N4OS/c1-9(2)6-7-11(18)15-13-17-16-12(19-13)10-5-3-4-8-14-10/h3-5,8-9H,6-7H2,1-2H3,(H,15,17,18) |
| InChIKey | DYUPWPOJYAKXLY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |