C17H14N4O3S — CID 55807297
2-(3-acetylphenoxy)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 55807297) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 55807297 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)Nc2nnc(-c3ccccn3)s2)c1 |
| InChI | InChI=1S/C17H14N4O3S/c1-11(22)12-5-4-6-13(9-12)24-10-15(23)19-17-21-20-16(25-17)14-7-2-3-8-18-14/h2-9H,10H2,1H3,(H,19,21,23) |
| InChIKey | LTHGIHSOARTNMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |