C20H18N2O4S — CID 7937389
2-(3-acetylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 7937389) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7937389 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)COc3cccc(C(C)=O)c3)n2)cc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-13(23)15-4-3-5-17(10-15)26-11-19(24)22-20-21-18(12-27-20)14-6-8-16(25-2)9-7-14/h3-10,12H,11H2,1-2H3,(H,21,22,24) |
| InChIKey | HCRRCVDRJIWNST-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |