C19H17ClN2O2S — CID 16549939
2-(3-chlorophenoxy)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 16549939) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 16549939 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)COc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C19H17ClN2O2S/c1-2-13-6-8-14(9-7-13)17-12-25-19(21-17)22-18(23)11-24-16-5-3-4-15(20)10-16/h3-10,12H,2,11H2,1H3,(H,21,22,23) |
| InChIKey | CYXGBMKKPBRLPN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |