C15H14N2O3 — CID 82312002
2-(3-acetylphenoxy)-N-pyridin-2-ylacetamide (PubChem CID 82312002) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-pyridin-2-ylacetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 82312002 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-pyridin-2-ylacetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C15H14N2O3/c1-11(18)12-5-4-6-13(9-12)20-10-15(19)17-14-7-2-3-8-16-14/h2-9H,10H2,1H3,(H,16,17,19) |
| InChIKey | YXSBOPVWFOGIRS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |