C18H18N4O2S — CID 55807465
3-(2-ethoxyphenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 55807465) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(2-ethoxyphenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 55807465 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(2-ethoxyphenyl)-N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCOc1ccccc1CCC(=O)Nc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C18H18N4O2S/c1-2-24-15-9-4-3-7-13(15)10-11-16(23)20-18-22-21-17(25-18)14-8-5-6-12-19-14/h3-9,12H,2,10-11H2,1H3,(H,20,22,23) |
| InChIKey | IEMRPCZAWPRROQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |