C13H16N4O2S — CID 122062814
(2S)-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)amino]hexanoic acid (PubChem CID 122062814) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is (2S)-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122062814 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2S)-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1nnc(-c2ccccn2)s1)C(=O)O |
| InChI | InChI=1S/C13H16N4O2S/c1-2-3-6-10(12(18)19)15-13-17-16-11(20-13)9-7-4-5-8-14-9/h4-5,7-8,10H,2-3,6H2,1H3,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | JYIYPGJUDBRQCG-JTQLQIEISA-N |
| XLogP | 2.66 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |